Describe the “Doppler Effect.” Explain how it is used in Astronomy in term of red shift and blue shift

Answers

Answer 1

Answer:

This apparent change in the pitch (or frequency) of sound is called Doppler shift. ... You see these stretched-out light waves as having a lower frequency. Since red is at the low-frequency end of the visible spectrum, we say that light from a receding star is shifted toward red, or red shifted.

Explanation:


Related Questions

A student heats 25 mL of water from 20°C to 96°C in a glass beaker. The
model represents the motion of the water molecules during heating.
Explain why some of the water molecules shown in the model have
longer arrows than other water molecules during heating.

Answers

Answer:

Because the have acquired energy from the heating process, that is why the start moving faster.

Explanation:

Hello.

In this case, since the  initial liquid water molecules have a certain energy content, which makes them move with the relatively medium velocity characteristic in liquid-phase substances, once energy starts being added, it is evidenced that the molecules acquire more energy which is able to make them move faster.

In such a way, since the initial water molecules velocity is marked by a medium range arrows, meaning that the molecules are moving not-so-fast, not-so-slow but the heated  water molecules are marked by longer arrows, meaning that they move faster, we infer that such velocity increase is due to the addition of heat due to the heating process from 20 °C to 96 °C (just before boiling).

Regards!

Molecular motion is the action of motion of the molecules or the particles in a specific direction. The molecules start moving faster due to the energy given by the heat.

What are the factors affecting molecular motion?

The movement of the molecules or the particles in the system is affected by the temperature and the heat given to the system by the external source.

The initial molecules have relative speed and motion in the system and after the addition of the factors the energy of the motion of the particles gets affected.

When the temperature of the water in the beaker is increased then the average kinetic energy of the molecules also increases and hence the motion of the molecules increases.

The medium ranged arrows depict the average speed of the molecule movement in the medium, while the longer arrows suggest the fast-moving molecules of the water.

Therefore, the heat increases energy and in turn the molecular motion.

Learn more about molecular motion here:

https://brainly.com/question/14240663

A student conducting a calorimetry investigation determines a negative ∆H. What does the negative value indicate about the reaction?

A. The reaction synthesized a single product.

B. The reaction was exothermic.

C. The reaction absorbed energy.

D. The reaction involved decomposition.

Answers

Answer:

a

Explanation:

correct

When ignited, a uranium compound burns with a green flame. The wavelength of the light given off by this flame is greater than that of _____.

Answers

Answer:

Ultraviolet light.

Explanation:

Uranium is a natural radioactive chemical element with the chemical symbol "U" and an atomic number of 92. Uranium is used for generating nuclear fuels which are typically used in powering atomic bombs and nuclear reactors in the field of electricity generation.

When ignited, a uranium compound burns with a green flame. The wavelength of the light given off by this flame is greater than that of ultraviolet light which typically ranges from 100nm to 400nm. Where, nm is represents nanometer.

Basically, when ignited, a uranium compound burns with a green flame having a wavelength of 4.30 x 10^-7m to 5 x 10^-7m.

why is water a neutral substance

Answers

Answer: Water is considered neutral because the concentration of hydrogen and hydroxide ions is the same

Explanation:

2. Using the following data, calculate the average atomic mass of magnesium (give your answer to the nearest
.01 ) : Show all work!
Isotope: Mg Percent abundance: 78.70%
24
Isotope: 'Mg Percent abundance: 10.13%
25
Isotope:
Mg Percent abundance: 11.17%
26

Answers

Answer:

24.32

Explanation:

From the question given above, the following data were obtained:

Isotope A:

Mass of A = 24

Abundance (A%) = 78.70%

Isotope B

Mass of B = 25

Abundance (B%) = 10.13%

Isotope C:

Mass of C = 26

Abundance (C%) = 11.17%

Average atomic mass of Mg =..?

The average atomic mass of Mg can be obtained as illustrated below:

Average atomic mass = [(Mass of A × A%)/100] + [(Mass of B × B%)/100] + [(Mass of C × C%)/100]

Average atomic mass = [(24 × 78.70)/100] + [(25 × 10.13)/100] + [(26 × 11.17)/100]

= 18.888 + 2.5325 + 2.9042

= 24.3247 ≈ 24.32

Therefore, the average atomic mass of magnesium (Mg) is 24.32

The diagram illustrates photosynthesis. Which best describes what is happening in the area marked X?

Answers

Answer:

You forgot to include the diagram use snipping tool to take a picture and upload it

Explanation:

A sample contains 110.68 g of calcium. How many moles is this?
(1 mole Ca = 40.08 g)
Round to the nearest tenth and do NOT include a unit. (.e. 2.9)
Helppppp

Answers

Answer:

About 2.8

Explanation:

Briefly explain why the bulk temperature of the water remains low (at room temperature)

Answers

If the humidity of the room is low, the water that contacts the air directly could evaporate and takes some energy from the bulk thus decreasing its temperature steadily. This allows the water to have a lower temperature.

will mark brainliest, please hurry! :>
When a hydroxyl group is substituted for a hydrogen atom in a hydrocarbon, what type of molecule results?
a.
an alcohol
c.
a carboxylic acid
b.
an amine
d.
a polymer

Answers

Answer:

ans. will be a. an alcohol

How much heat, in kilojoules, must be added to a 580 g aluminum pan to raise its temperature from 25∘C to 150∘C?
---The specific heat capacity for aluminum is 0.897 J/g∘C.
---Round the answer to two significant figures.

Answers

Answer:

Q = 65 kJ

Explanation:

Given that,

Mass, m = 580 g

Initial temperature, [tex]T_i=25^{\circ} C[/tex]

Final temperature, [tex]T_f=150^{\circ} C[/tex]

The specific heat capacity for aluminum is 0.897 J/g°C

We need to find the heat added to the aluminium pan so that its heat raised to a temperature from 25°C to 150°C. It is given by :

[tex]Q=mc\Delta T\\\\Q=580\ g\times 0.897\ J/g^{\circ} C\times (150-25)^{\circ} C\\\\Q=65032.5\ J[/tex]

or

Q = 65.03 kJ

or

Q = 65 kJ

Hence, the heat added to the pan is 65 kJ.

When two or more different elements unite chemically, they form a

A) compound
B) mixture
C) metalloid
D) solution

Answers

Answer:

compound ahhhhhhhhhhhhhgh

What is the difference in drawing Lewis Dot
Structures for ionic and covalent bonds?

Answers

Answer:

In Lewis Dot Structure of Covalent compound it never contain any charge and for Ionic compounds always contain charges.

The Lewis Dot Structure for ionic compounds must demonstrate how the electrons are transported to create the ions in the compound. The Lewis Dot Structures of covalent compounds must demonstrate how the electrons are being shared to finish the octets of each atom in the molecule.

What is an ionic compound ?

A chemical compound known as an ionic compound is one that contains ions bound together by the electrostatic forces known as ionic bonding. Despite having both positively and negatively charged ions, or cations and anions, the molecule is generally neutral.

The term "ionic bonding" refers to a bond in which the ionic character is greater than the covalent character, i.e., when there is a significant difference in the electronegativity of the two atoms, which makes the bond more polar (ionic) than in a covalent bond, where the electrons are distributed more evenly.

The Lewis structures are not frequently drawn for ionic compounds due to the electrical motion of electrons.

Thus, The Lewis Dot Structure for ionic compounds must demonstrate how the electrons are transported to create the ions in the compound.

To learn more about an ionic compound, follow the link;

https://brainly.com/question/9167977

#SPJ2

The purpose for witch something is designed or exists

Answers

Answer:

to help

Explanation:

to help

An aqueous solution is in equilibrium with a gaseous mixture containing an equal number of moles of helium, carbon dioxide, and nitrogen. Rank the relative concentrations of each gas in the aqueous solution from highest to lowest. An aqueous solution is in equilibrium with a gaseous mixture containing an equal number of moles of helium, carbon dioxide, and nitrogen. Rank the relative concentrations of each gas in the aqueous solution from highest to lowest.
[CO2][CO2] > [He][He] > [N2][N2] [N2][N2] > [CO2][CO2] > [He][He] [CO2][CO2] > [N2][N2] > [He][He] [He][He] > [N2][N2] > [CO2][CO2]

Answers

Answer:

[CO2] > [N2] > [He]

Explanation:

The relative concentration of CO2, N2 and He depends on the solubility of each gas in water. The more soluble in water a gas is, the greater its concentration in aqueous solution.

Among the gases listed, CO2 is most soluble in water hence it is expected to have the greatest concentration in solution followed by N2. Helium gas is insoluble in water hence it has the least concentration in the aqueous solution.

If a feather and in Marble are dropped at the same time from the same height explain. Which object would hit the floor first based on air resistance?​

Answers

Answer:

the marble would hit the floor first because the feather would be effected by air resistance

WHAT IS A NEWTON!! specifically the definition!!!!

Answers

Answer:

Explanation:

the SI unit of force. It is equal to the force that would give a mass of one kilogram an acceleration of one meter per second per second, and is equivalent to 100,000 dynes.

What is the first step when using a microscope?


A. Place the microscope slide on the stage

B. Plug the microscope in and turn it on

C. Switch to the low power objective lens

D. Secure the slide to the stage clips

Answers

Answer:

I think the answer is B :)

Answer:

the first step is B

Explanation: I'm on this lesson

The strength of an acid is affected by the polarity of the bond connected to the acidic hydrogen. The more highly polarized this bond, the more easily the hydrogen is ionized. Electronegative atoms or groups of atoms present in the structure of an acid can act to withdraw electrons and produce additional polarization. Two common groups of acids to which this principle can be applied are oxyacids and carboxylic acids. Arrange the following oxyacids in order of decreasing acid strength. Rank from strongest to weakest acid.

a. HBrO
b. HClO
c. HClO3
d. HClO2

Answers

Answer:

Explanation:

Oxyacids are acid containing oxygen; they are also known as acid-alcohol or acid-phenol. As said earlier, the strength of these acids increases with increases in the polarity of these compounds. So, what makes the polarity is as a result of the electronegative substituents attached to it. Halogen family possesses the highest electronegativity in the periodic table, and electronegativity decreases down the group.

The ranking of the oxyacids in order of decreasing acid strength from strongest to weakest acid is:

HClO3 > . HClO2 > HClO > HBrO

Why can stars be called element factories?

Answers

Answer:

They came from the element factories we call stars. Stars are mostly hydrogen throughout most of their lifespans. They are driven by massive and continuous thermonuclear reactions and gravity. ... This extra heat begins to fuse helium atoms into heavier elements like carbon and oxygen and gives new life to the star.

Explanation:

Nearly all elements heavier than hydrogen were not created by the Big Bang. They came from the element factories we call stars. ... This extra heat begins to fuse helium atoms into heavier elements like carbon and oxygen and gives new life to the star. BTW I GOT THIS FROM SAFARI :)

When an objects volume is made smaller and it’s mass remains the same it’s density

Answers

Density decreases when volume increases if mass is kept constant. Density is defined as mass divided by volume.

Which properties do not change the composition of a substance?

neither chemical nor physical properties

physical properties

chemical properties

chemical and physical properties

Answers

Answer:

Physical Properties

Explanation:

PHYSICAL PROPERTY

Answer:

phycical propertys

Explanation:

jut took the test got it right


Which among the given combinations below represent a set of isotopes?

1.40 protons and 40 neutrons
II. 41 protons and 39 neutrons
3.42 neutrons and 48 protons
4 40 protons and 42 neutrons
V. 41 protons and 40 neutrons

A. I, II, III
B. III, IV
C.1, IV and II, V
D. 1, V and II. V
E.1. V​

Answers

Look for the ones with the same number of protons and different neutrons number

What change would you expect on the rate of the SN2 reaction of 1-iodo-2-methylbutane with cyanide ion if the nucleophile concentration is halved and the alkyl halide concentration is doubled

Answers

Answer:

The rate of reaction remains the same, no change is observed

Explanation:

Remember that for an SN2 reaction, the rate of reaction depends both on the concentration of the alkyl halide and the concentration of the nucleophile.

Hence we can write; Rate = k [Alkyl halide][NaI]

This implies that if we half the concentration of the nucleophile and double the concentration of the alkyl halide, the rate of reaction just remains the same since the reaction is bimolecular and first order in both alkyl halide and nucleophile

How is the periodic table generally arranged?

Answers

Answer:

It is generally arranged by the atomic number

Explanation:

Which pair of elements are most likely to form a molecular compound?

Nitrogen and Hydrogen

Calcium and Copper

Chlorine and Neon

Please help! I will mark brainliest if correct!

Answers

Answer: Two nonmetals.

Explanation:

Answer:The only pair of nonmetals is sulfur and fluorine.

Explanation:The pair of elements most likely to form a molecular compound with each other are two nonmetals.

Help asap!!!!
What are elements in the tall columns of the periodic table called?
A. Representative elements
B. Valence elements
C. Atomic elements
D. Period elements

Answers

The elements in the tall columns of the periodic table are called representative elements or main group elements. They exhibit similar chemical properties within their respective groups due to their shared number of valence electrons. The terms "valence elements," "atomic elements," and "period elements" are not commonly used or recognized in the context of the periodic table.

The correct answer is option  A.

The elements in the tall columns of the periodic table are called "A. Representative elements," also known as the "main group elements" or "group A elements." These elements are found in groups 1, 2, and 13 to 18 (excluding the transition metals) on the periodic table.

Representative elements are characterized by having similar chemical properties within their respective groups. This similarity arises from the fact that elements within the same group have the same number of valence electrons, which are the electrons in the outermost energy level of an atom. Valence electrons play a crucial role in determining the chemical behavior and reactivity of an element.

The representative elements include the alkali metals (Group 1), alkaline earth metals (Group 2), boron group (Group 13), carbon group (Group 14), nitrogen group (Group 15), oxygen group (Group 16), halogens (Group 17), and noble gases (Group 18). These elements exhibit a wide range of properties, from highly reactive metals to nonmetals and inert gases.

The term "valence elements" mentioned in option B is not commonly used in the context of the periodic table. Valence electrons are indeed significant in determining chemical properties, but they are not specific to the elements in the tall columns. Valence electrons are found in elements across the periodic table.

"Atomic elements" mentioned in option C is a vague term and does not specifically refer to the elements in the tall columns. All elements on the periodic table are atomic in nature, as they are composed of atoms.

"Period elements" mentioned in option D is not a recognized term in the context of the periodic table.

In conclusion, the elements in the tall columns of the periodic table are known as representative elements or main group elements. These elements exhibit similar chemical properties within their respective groups due to their shared number of valence electrons.

Therefore, from the options provided the correct one is A.

For more such information on: representative elements

https://brainly.com/question/17105472

#SPJ8

The force of 20 N acts upon a 5kg block. What is the acceleration of the block?
100 m/s/s
4 m/s/s
O 25 m/s/s
O 0.25 m/s/s

Answers

Answer:

The answer is 4 m/s²

Explanation:

The acceleration of an object given it's mass and the force acting on it can be found by using the formula

[tex]a = \frac{f}{m} \\ [/tex]

where

a is the acceleration

f is the force

m is the mass

From the question

f = 20 N

m = 5 kg

We have

[tex]a = \frac{20}{5} \\ [/tex]

We have the final answer as

4 m/s²

Hope this helps you

please help

Air masses that form over large bodies of water are moist. What process determines the amount of moisture in an air mass?

Answers

Answer:

I don't know if this is right but try it. The amount of water vapor in the air is called absolute humidity. The amount of water vapor in the air as compared with the amount of water that the air could hold is called relative humidity. This amount of space in air that can hold water changes depending on the temperature and pressure.

what is heavier 1 pound of bricks or 1 pound of feathers

Answers

Answer:

They are both the same.

Explanation:

ONE POUND of feathers

ONE POUND of brick

Answer:

They are both the same

Explanation:

Even though feathers are lighter they are both 1 pound. Why do you have so many feathers?!?!?


The human eye cannot see anything less than 40 micrometers in size. What is this length in meters?

Answers

Answer:

4e-5 is the length in meters

Have a nice day! :)

Other Questions
Create a good plan of healthy food for three days (breakfast, lunch and dinner) Given the following information regarding an income producing property, determine the internal rate of return (IRR) using levered cash flows. Expected Holding Period: 5 years; 1 year Expected NOI: $89,100; 2 year Expected NOI: $91,773; 3 year Expected NOI: $94,526; 4 year Expected NOI: $97,362; 5 year Expected NOI: $100,283; Debt Service in each of the next five years: $58,444; Current Market Value: $885,000; Required equity investment: $221,250; Net Sale Proceeds of Property at end of year 5: $974,700; Remaining Mortgage Balance at end of year 5: $631,026.A) 10.6%B) 12.2%C) 22.9%D) 33.4% In conservation plowing, why are dead weeds and stalks of the previous year's crop left in the ground?a. to keep the soil from becoming too fertileb. to reduce the amount of seed needed for the next year's cropC. to retain moisture and hold the soil in placed. to keep more organisms out of the soil HEEEELLPP (Hinduism) Belief or Teachings:1. Religious and social duty of every person: 2. Rebirth into a different life-form: 3. Liberation from the cycle of birth and death: 4. Idea that every good or bad act has an effect: 5. Eternal spiritual force: what are logos and can u give me some examples 2/3 x - 1 = 9 - 1/6 x Im supposed to solve but i need some help out of fifty students,34 joined the journalism class and 25 joined robotics club.if 16 students joined both clubs,how many students are in neither club?how many are in either club? show the venn diagram 8+-2w>4 I dont know this i gotta solve fore w. Statement of Cash Flows Colorado Corporation was organized at the beginning of the year, with the investment of $251,500 in cash by its stockholders. The company immediately purchased an office building for $304,900, paying $212,700 in cash and signing a three-year promissory note for the balance. Colorado signed a five-year, $60,500 promissory note at a local bank during the year and received cash in the same amount. During its first year, Colorado collected $93,970 from its customers. It paid $66,500 for inventory, $20,500 in salaries and wages, and another $4,000 in taxes. Colorado paid $6,200 in cash dividends.Required1. Prepare a statement of cash flows for the years2. What does this statement tell you that an income statement does not? Which answer choice accurately describes passive voice?In the passive voice, the subject does not perform the action of the verb.In the passive voice, the subject takes an active role.In the passive voice, there are more subjects than objects.In the passive voice, the subject performs the action of the verb. Read the passage and study the drawing from Sugar Changed the World.A drawing from 1623 shows slaves working at various tasks on a sugar plantation.How does the image most support the central idea of this text?It emphasizes how time-consuming the sugar-making process was.It illustrates the importance of a warm climate to sugar production.It shows the large numbers of workers and tasks required to refine sugar.It clarifies the many differences between producing sugar and producing honey. Please help8 square root 5 minus square root 45 The length of a car is 15 2/5 meters. What is the length of 7 cars? Which expression is equivalent to sin(20)cos(80) cos(20)sin(80)?sin(60)cos(60)cos(60)sin(60) Find the number of moles of iron atoms obtainfrom 320kg of iron (3) oxide How is por being used in the following sentence? Yo estudl por clnco horas. A. To give a reason B. To indicate a length of time C. To say for whom something is done D. To talk about an exchange Which polynomial represents the area? What statements accurately describe sunspots? Check all that apply.Sunspots are storms on the Sun's surface.Sunspots are marked by intense magnetic activity.Sunspots produce solar flares and hot gassy ejections.Sunspots can affect Earth's climate.Sunspots are cool areas where the Sun is covered by clouds. Which one of the following equations is equivalent to 3x-12 = -9?A 3 - 5 = -6B 70 - 3=42x = 4D 2+3 = 2 - 1 Angle pair equations!! 10 points :)