state the iupac name for CH₃(CH2)₃C(CH₃)₃ ​

Answers

Answer 1

Answer:

CH3CH2COCl consists of three carbon atoms in the parent chain and chloroformyl group(-COCl). Therefore the name of the compound is Propanoyl chloride.


Related Questions

Why is our mindset more important when you try to learn remotely than when you are learning face to face?

Answers

Answer:

It is more important because of the freedom.

Explanation:

While at home you can do your work of course... but you could lay down, take a nap. You could get on the game, play around. You could draw, and fiddle and dance and do WHATEVER you want with no teacher to stop you so you have to be your own motivation. You have to be your own teacher or its VERY easy to fail.

Determine which equations you would use to solve the following problem: Calculate the amount of heat needed to change 20.0 g of ice at -10.0°C to water at 89.0°C.

Answers

Answer:

Q = 4019.4 J

Explanation:

Given data:

Mass of ice = 20.0 g

Initial temperature = -10°C

Final temperature = 89.0°C

Amount of heat required = ?

Solution:

specific heat capacity of ice is 2.03 J/g.°C

Formula:

Q = m.c. ΔT

Q = amount of heat absorbed or released

m = mass of given substance

c = specific heat capacity of substance

ΔT = change in temperature

ΔT = T2 - T1

ΔT =  89.0°C - (-10°C)

ΔT = 99°C

Q = 20.0 g ×2.03 J/g.°C × 99°C

Q = 4019.4 J

How many molecules of CO2 are contained in 4.40g of CO2

Answers

Answer:

6.02 x 10²²molecules

Explanation:

Given parameters:

Mass of CO₂  = 4.4g

Unknown:

Number of molecules in CO₂  = ?

Solution:

To find the number of molecules in the given mass, we have to find the number of moles in the compound first;

   Number of moles  = [tex]\frac{mass}{molar mass}[/tex]  

Molar mass of CO₂  = 12 + 2(16) = 44g/mol

Insert the parameters and solve;

   Number of moles  = [tex]\frac{4.4g}{44g/mol}[/tex]   =  0.1mol

  1 mole of a substance contains 6.02 x 10²³molecules

  0.1 mole of CO₂ will contain 0.1 x 6.02 x 10²³molecules

                                                 = 6.02 x 10²²molecules

Helpppppp!!!!! It’s due today
URGENT!!!!!

Answers

Answer:

Explanation:

2. a [CO3 2-][H3O+] / [H2O][HCO3-

b. [H2PO4-][H3O+]/[H3PO4][H2O]

What is the mass of one electron in grams if an electron has the charge of
-1.6022 x 10-19C and lg = -1.76 x 108 C.

Answers

The mass of one electron : 9.103 x 10⁻²⁸ g

Further explanation

Electrons are a part of the atomic nucleus particles (including protons and neutrons), and are negatively charged (-1)

An electron has the charge of  -1.6022 x 10⁻¹⁹C

1 g =  -1.76 x 10⁸ C

so the mass of one electron :

[tex]\tt \dfrac{1.6022\times 10^{-19}}{1.76\times 10^8}=9.103\times 10^{-28}~g[/tex]

PLZ ANSWER! MULTIPLE CHOICE!! MUST BE CORRECT!! I CANNOT GET THIS WRONG.

Answers

The answer is B, the second choice

Please help me with my Chemistry homework!! I have so much homework to do for other classes and I’m so stressed so even answering one question would be amazing!!!

1. A graduated cylinder had an initial volume of water of 22 mL. After an iron nail is dropped into the cylinder, the water rises to 38 mL. What is the volume of the nail?

2. Ms.Chavez dropped a gold ring into a graduated cylinder filled with water. The water level was originally at 20 mL. Now the water is at 25mL. Ms.Chavez knows that means the volume of the ring is 5 mL. What else would she have to do to find the density of her ring? Explain.

3. A simple of liquid propanol has a volume of 20.0 cm*^3 and a mass of 15.0 g. What is the density of propanol? Write only your answer below.

Answers

1. 16 mL

2. She need to find the mass, as density is mass divided by volume.

3. 0.75 g/cm^3

OK HURRY AND PLEASE ANSWER COZ THIS TEST IS TIMED BROS

What is the sum of the coefficients in the balanced chemical equation for the combustion of acetone, C3H6O(l), in air?
Express answer as an integer

Answers

Answer:

C3H6O + 4O2 → 3CO2 + 3H2O or 11

Explanation:

Answer:

11

Explanation:

What is arcade in south Center

Answers

Answer: game stop and mind games

Explanation:

i live near there

Arrange the elements in order of increasing ionization energy. Use the
periodic table to identify their positions on the table.
Drag each tile to the correct box.
Hola
Tiles
chlorine
fluorine
gallium
phosphorus
Sequence

Answers

Answer:

Gallium - Phosphorous - Fluorine - Chlorine

Explanation:

Answer:

Gallium < Phosphorus < Chlorine < Fluorine

Explanation:

<3

Analysis of a sample of an oxide of nitrogen gave 47% of nitrogen.What is the empirical formula of the oxide?

Answers

Answer:

N2O

Explanation:

hope am right.....

carbon and tin are both in the fourth column of the table which would you expect to have the greater electronegativity

Answers

Answer: Carbon

Explanation:

electronegativity decreases when you go down a column

The study of chemical bonds is called chemistry.

The correct answer is carbon.

The more negative charge present on an atom shows the electronegativity.

The attraction of the nucleus to the proton is also referred to as electronegativity.

The smaller the radius more the electronegativity.

Hence, the correct answer is Carbon as it has fewer atoms and a smaller radius.

For more information, refer to the link:-

https://brainly.com/question/12985618

An unbalanced chemical equation is shown:

2NaN3 → 2Na + N2

Which of the following statements explains why the equation is not balanced?

Four molecules of N2 should be produced during the decomposition.
Three molecules of N2 should be produced during the decomposition.
Four molecules of N2 should be produced during the synthesis reaction.
Three molecules of N2 should be produced during the synthesis reaction.

Answers

The correct statement is B. Three molecules of N₂ should be produced during the decomposition. :)

Answer: b

Explanation: I took the quiz

The diagram is a model of one way that materials move into a cell.


Which Sentence explains what happens in last step?

A. a vacuole carries particles into the cell
B. The cell membrane surrounds particles outside the cell.
C. Phospholipids in the cell membrane allow particles to pass through
D. Transport proteins push particles out of cell.

Answers

Answer:

B. The cell membrane surrounds particles outside the cell.

Explanation:

The last step is when the cell membrane completely surrounds particles outside the cell.

This process is often known as endocytosis.

endocytosis is the process whereby a cell ingests materials by engulfing them using the cell membrane. In this process, the cell membrane completely covers the food.

HELPP ME

express with equations the transformations marked on the scheme

Answers

Further explanation

The reaction equation is the chemical formula of reagents and product substances

A reaction coefficient is a number in the chemical formula of a substance involved in the reaction equation. The reaction coefficient is useful for equalizing reagents and products.

Transformations :

1. CaO + H₂O⇒Ca(OH)₂

2. CaO + CO₂⇒CaCO₃

3. Ca(OH)₂+ 2HCl⇒CaCl₂+2H₂O

4. Ca(OH)₂+H₂CO₃⇒CaCO₃+2H₂O

5. CaCO₃⇒CaO+CO₂

An oxide named CrO. So the salt of chromium has the corresponding valence​

Answers

Answer:

this question doesnt make any sene

Explanation:

The average speeds of gas molecules in cylinders A, B, C, and D are 0.001 m/s, 0.05 m/s, 0.1 m/s, and 0.5 m/s respectively. Which cylinder contains gas that is closest to absolute zero?​

Answers

Answer:

cylindar a

Explanation:

I took the test

Answer:

A

Explanation:

Calculate the gravitational force between two objects when they are 0.75m apart each object has a mass of 5.00kg

Answers

Answer:

0.000000000666863

Explanation:

F = GMm/R²

the process that breaks down rocks

Answers

Weathering is the breaking down or dissolving of rocks and minerals on earths surface!

SECOND SCIENCE WORKSHEET:
Answer the following:
1:
Which type of cell has a cell wall?
2: What is the smallest part of any substance?
3:
What is used to see tiny objects?
4: What name is given to a substance where all the atoms are the
same?
5: What does the safety symbol with flames mean?
6: What gives the ability to do work?
7: Which part of the cell controls all cell activity?
8: By what process does a liquid change to a gas?
I

Answers

Answer:

1 animal cell

2?

3 mircoscope

4?

5 it means whenever you becareful

7. Which of the following is unlikely to
happen to zinc?
A) It is rolled into sheets.
B) It is used to coat a steel hull.
C) It is used in a battery.
D) It is used as an insulator.

Answers

Answer:D) it is used as an insulator

Explanation:

Astronomers observed that the orbit of Uranus was not uniform. Therefore, they hypothesized the existence of another planet. This is an example of scientific investigation being led by _____.

Inductive Reasoning
Deductive Reasoning

Answers

Answer:

This is an example of scientific investigation being led by inductive reasoning.

Explanation:

Inductive reasoning is the type of reasoning used to make broad generalizations from specific observations. We have certain pieces of data and make conclusions based on them. In the given example, astronomers have made a specific observation - that the orbit of Uranus isn't uniform. Based on that fact, they made a broader conclusion - that there is another planet. There are probably more things that could lead to the same conclusion.

The opposite is deductive reasoning, where a person starts off with a broad generalization and tries to make specific, logical conclusions based on it.

a gas tank is under 1 atm pressure at room temperature. if the temperature halved,what will happen to the pressure ​

Answers

Answer:

The pressure will also be halved.

Explanation:

Gay-Lussac's law states that the relationship between temperature and pressure is directly proportional to each other. If the temperature goes up, so will the pressure.

Which best describes why NH4+ can form an ionic bond with CF?

Its outermost shell gains one or more electrons from CF.

Its positive charge is attracted to the negative charge of Cr.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cr.

Answers

Answer:

Its positive charge is attracted to the negative charge of Cl-

Note: The correct question is given below:

Which best describes why NH4+ can form an ionic bond with Cl-?

Its outermost shell gains one or more electrons from Cl-.

Its positive charge is attracted to the negative charge of Cl-.

It has a negative charge that is spread over the entire ion.

It has a nitrogen atom that is strongly attracted to Cl-.

Its positive charge is attracted to the negative charge of Cl-.

Explanation:

An ammonium ion is a positively charged ion which is composed of a molecule of ammonia and a hydrogen ion which are in a coordinate covalent bond due to the lone pair of electrons of the nitrogen atom in the molecule ammonia. The chloride ion however, has an extra electron which gives it a negative charge.

An ionic bond is formed between two oppositely charged ions by a transfer of electrons from one atom to another. It usually occurs between non-metals and metals. However, that formed between ammonium ion and chloride ion is between non-metals entirely.

Due to electrostatic attraction between the oppositely charged ions, an ionic bond is formed between ammonium ion, NH4+, and chloride ion, Cl-.

Which container has gas stored at the highest temperature

Answers

Answer: 3

Explanation:

Answer:

kinetic energy

Explanation:

may be iam not sure

_________feedback is a type of feedback in which a system is triggered to produce an output.

Answers

Answer:

positive

Explanation:

Answer:

Positive feedback is a type of feedback in which a system is triggered to produce an output.





Explanation:

Have a great rest of your day
#TheWizzer

Match these solutions with their examples:
Liquid in liquid
Solid in liquid
gas in liquid
gas in gas
solid in solid
liquid in solid
Gas in solid

Examples
A. Air
B. seawater
C. marshmallow

Answers

Answer:

sea water

Explanation:

a sea water can match the following

What is the pressure inside a 2.0 L bottle filled with 0.25 mol of carbon dioxide gas at 25 °C?

Answers

Answer:

3.1atm

Explanation:

Given parameters:

Volume of gas = 2L

Number of moles  = 0.25mol

Temperature  = 25°C = 25 + 273  = 298K

Unknown:

Pressure of the gas = ?

Solution:

To solve this problem, we use the ideal gas equation.

This is given as;

       PV  = nRT

P is the pressure

V is the volume

n is the number of moles

R is the gas  constant  = 0.082atmdm³mol⁻¹K⁻¹

T is the temperature

          P  = [tex]\frac{nRT}{V}[/tex]  

 Now insert the parameters and solve;

         P  = [tex]\frac{0.25 x 0.082 x 298}{2}[/tex]   = 3.1atm

Which is the molecular shape of water, H20, according to the VSEPR theory?
A. Bent
B. Tetrahedral
C. trigonal pyramidal
D. Trigonal planar

Answers

Answer:

the answer is A

Explanation:

Use the equation below to solve the problem that follows.

2H2 (g) + O2 (g) → 2H2O (g)

When David reacts 13.8 grams of hydrogen gas with excess oxygen, 87.0 grams of water are formed. Calculate his percent yield of water.

Answers

Percent yield = 70%

Further eplanation

Percent yield is the comparison of the amount of product obtained from a reaction with the amount you calculated

General formula:

Percent yield = (Actual yield / theoretical yield )x 100%

An actual yield is the amount of product actually produced by the reaction. A theoretical yield is the amount of product that you calculate from the reaction equation according to the product and reactant coefficients

Reaction

2H₂ (g) + O₂ (g) → 2H₂O (g)

mass of H₂O (theoretical) :

[tex]\tt mass=mol\times MW(mol~ratio~H_2O\div H_2=2\div 2)\\\\mass=(\dfrac{2}{2}\times \dfrac{13.8}{2})\times 18~g/mol\\\\mass=124.2~g[/tex]

percent yield

[tex]\tt \%yield=\dfrac{87}{124.2}\times 100\%=\boxed{\bold{70\%}}[/tex]

Other Questions
PLEASE HELP I ONLY HAVE 17 MORE MINUTES!!!! Answer the following questions about the directors choices in adapting Stranded into a staged performance. Select Yes or No.The sweltering afternoon sun beat down mercilessly upon the road, browning their faces and the sad, parched grasses along the roadside. Steves boots crunched heavily along the gravel shoulder. With each step, the noise rankled slightly more. Ramon wiped a trickle of sweat from his temple and shifted the cat carrier to his right hand. (Its occupant made a single vocal protest.) And why, he huffed testily, is it my job to carry your cat?A few steps behind, Steve rolled his eyes and groaned. Oh for the love of Pete! Fine, give her to me. Ramon thrust the carrier into his hands. Steve peeked inside, clucking his tongue at the cat. Ramon is so grumpy, isnt he, kitty? He acts like this is all our fault.Because it is all your fault! Ramon burst out, and launched into a tirade about every step of their miserable journey. How Steve had left the car unlocked, and how the car had been stolen. How the cab driver had refused to take the cat along, and how Steve had forgotten to charge his phone, and so now they were walking all the way home . . . . And the heat, Steve interrupted sarcastically, dont forget, its my fault that its hot out, too. Ramon fell silent a moment, then sighed heavilyreally, more of a growl than a sigh. Youre right, I apologize, he mumbled. And hey, at least you knew the right road to get us back home. Yeah, Steve said in a wavering voice, I mean, probably . . . . This is almost probably definitely the right road. He braced himself for another onslaught, but Ramon just laughed.Well it goes somewhere, anyway. Roads always do go somewhere. A. The end of the staged scene changes the story's resolution. (Yes or No)B. The changes to the setting change the storys meaning. (Yes or No)C. The changes made to the characters affect the scene's meaning. (Yes or No)D. Adding dialogue to the scene helps the director develop both Steve and Alyce further. (Yes or No)E. The staged scenes conflict is faithful to the original. (Yes or No) 1Robert climbed 775 steps in 12 minutes.2How many steps did he average per minute? The last 2 questions & did I do it right pls help me:( What best describes the mood the setting creates for the audience?WILL GIVE BRAINLIESTA. annoyedB. expectantC. overwroughtD. suspicious In a short paragraph, describe two examples ofhow changes to the railroad helped Americanindustries to grow. how does disk service time affect the disk drive performance 11,880 yd = How many Miles? PLS HELP With this Question!!! choose the correct answer to the question. como lo explicaran ellos?Lo explicarn con cuidado.Lo explicaremos con cuidado.Lo explicar con cuidado.Lo explicar con cuidado. Why had her mother refused to leave to Palestine?She didn't want to leave her parents.She wanted to stay with her friends.She was afraid to travel.She thought it was a dirty country. The setting and culture of a story should always be taken into consideration when analyzing it.TrueFalse AB = BC5(2x + 2).3(3x - 1)Find x:24-1016None of the other answers are correct someone please answer please!Svetlana Masterkova of Russia set a record when she ran 1 mile in 4 minutes, 12.56 seconds. What was her time in miles per hour? What game was everyone playing at the arcade bushnell managed Craig and Jeff are comparing their plans for downloading songs. Craig pays a monthly fee of $5.50 and then $0.25 per song he downloads. Jeffpays $0.80 for each song he downloads. What number of downloaded songs result in Craig and Jeff having the same monthly cost? examine the diagram of cell. which organelle is marked with an X What Most Often Causes The Availability Of Water To Change? A. type of plants B. type of soilC. local geography Complete the synthetic division problem below.-1/ 2 8 6What is the quotient in polynomial form?O A. X-6O B. X+6C. 2x + 6D. 2x-6 What is the equation for This graph ?