what is 21 5/8% as a decimal

Answers

Answer 1

Answer: 21.625

Step-by-step explanation:

Answer 2

The percentage of 21 (5/8)% in decimal form is 173/800.

We have,

The percentage means the required value out of 100.

It is calculated by dividing the required value by the total value and multiplying by 100.

The given percentage expression.

21(5/8) %

Divide by 100 to remove the %.

This can be written as,

21(5/8) / 100

Now,

21(5/8)

= (21 x 8 + 5) / 8

Simply the fraction.

= 173/8

Now,

173/8 / 100

Simplify the fraction.

= 173/800

Thus,

The percentage of 21 (5/8)% in decimal form is 173/800.

Learn more about percentages here:

https://brainly.com/question/11403063

#SPJ4


Related Questions

-2 4/5 divided by -7

Answers

Answer:

2/5 or 0.4

Step-by-step explanation:

convert -14/5 / (-7)

divide 14/5 / 7  ( two negatives equal a positive)

equals 2/5 or 0.4 in decimal

the answer is 2/5 and an alternative form would be 0.4

HELP ASAP 6TH GRADE WORK LOOK AT PHOTO

Answers

The simplified exponential function is determined as x⁴.

What is the simplification of the exponential function?

An exponential function is a mathematical function used to calculate the exponential growth or decay of a given set of data.

To simplify an exponential function, we will apply the rules of exponent as shown below;

The given exponential function;

= (∛ x² )⁶

The given expression is simplified as follows;

= [tex](x^2) ^{\frac{1}{3} \times 6}[/tex]

= ( x² )²

= x⁴

Thus, the simplified exponential function is determined by applying the rules of multiplication of powers.

Learn more about exponential functions here: https://brainly.com/question/30241796

#SPJ1


Find the volume of a cylinder that has a radius of 1/2and a height of 1.

Answers

Answer:

0.79

Step-by-step explanation:

What is the value of x in this figure?
Enter your answer in the box.
x=

Please help meeee!!

Answers

Answer:

x=48°

Step-by-step explanation:

We two lines cross over each other, making four angles, the angles opposite each other are equal. They're called vertically opposite angles.

x=48 degrees
extra characters:hsjahjshajsjanns

PLEASE HELP ME

Drag the tiles to the boxes to form correct pairs. Not all tiles will be used.
Match the expressions with their simplified forms.

Answers

(a) √2 · √8. The simplified surd expression is 4.

(b) √80. The simplified surd expression is  4√5.

(c) √5/√20. The simplified surd expression is  1/2.

(d) √20. The simplified surd expression is  2√5.

What is the simplification of the surd expression?

The given surd expression is simplified as follows;

(a) √2 · √8

we can simplify it as;

√2 · √8 = √(2 x 8) = √16 = 4

(b) √80

we can simplify it as;

√80 = √ (16 x 5) = √16  x √5 = 4√5

(c) √5/√20

we can simplify it as;

√5/√20  x  √20 / √20

= (√5  x √20 ) /(20)

= √100 / 20

= 10/20

= 1/2

(d) √20

we can simplify it as;

√20 = √4  x √5 = 2√5

Learn more about surd simplification here: https://brainly.com/question/25119327

#SPJ1

Please help question in the picture

Answers

Answer:

64 m²

Step-by-step explanation:

Area of the trapezoid = ½(a + b)h

Where,

a = 6 m

b = 10 m

h = 8 m

Plug in the values

Area = ½(6 + 10)*8

Area = ½(16)*8

Area = 8*8

Area = 64 m²

Two students in different classes took the same math test. Both students received a
score of 87. In student A's class the mean was 78 and the standard deviation of 5. In
student B's class the mean was 76 with a standard deviation of 4. Which student
scored in the top 10% of their class?

Answers

Answer:

Both students scored in the top 10% of their classes.

Step-by-step explanation:

Normal Probability Distribution:

Problems of normal distributions can be solved using the z-score formula.

In a set with mean [tex]\mu[/tex] and standard deviation [tex]\sigma[/tex], the z-score of a measure X is given by:

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

The Z-score measures how many standard deviations the measure is from the mean. After finding the Z-score, we look at the z-score table and find the p-value associated with this z-score. This p-value is the probability that the value of the measure is smaller than X, that is, the percentile of X. Subtracting 1 by the p-value, we get the probability that the value of the measure is greater than X.

In this question:

Top 10% = Above the 100 - 10 = 90th percentile.

The 90th percentile of scores is X when Z has a pvalue of 0.9, that is, Z = 1.28.

So, the student who had a z-score above 1.28 scored in the 90th percentile of their class.

In student A's class the mean was 78 and the standard deviation of 5. He scored 87.

We have that [tex]\mu = 78, \sigma = 5, X = 87[/tex]

Then

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{87 - 78}{5}[/tex]

[tex]Z = 1.8[/tex]

1.8 > 1.28, so student A scored in the top 10% of his/her class.

Student B's class the mean was 76 with a standard deviation of 4. Scored 87.

We have that [tex]\mu = 76, \sigma = 4, X = 87[/tex]

Then

[tex]Z = \frac{X - \mu}{\sigma}[/tex]

[tex]Z = \frac{87 - 76}{4}[/tex]

[tex]Z = 2.75[/tex]

2.75 > 1.28, so student B also scored in the top 10% of his/her class.

Both students scored in the top 10% of their classes.

Can I have some help I don't really understand this question.

Answers

Answer:

40 square units

Step-by-step explanation:

This is a rhombus, so you multiply the two diagonals and divide by 2.

8x10÷2=40

Which of the following would be the most appropriate unit to measure the volume of a bucket?

A. inch
B. cubic mile
C. cubic centimeter
D. cubic kilometer

Answers

Answer:

Volume uses cubic ___  

A mile or kilometer is to big

So an cubic centimeter is about right

C

Find the probability of exactly two
successes in five trials of a binomial
experiment in which the probability of
success is 50%.
Round to the nearest tenth of a
percent.

Answers

Answer:

Step-by-step explanation: 0.5

find the surface area of the rectangular prism.
A 90 cm2
B 135 cm2
C 225 cm2
D 270 cm2

Answers

Answer:

D. 270 cm2

Step-by-step explanation:

2*(15*5 + 15*3 + 5*3) = 270 cm2

Equilateriall triangle. Find the length of side X in simple radical form with a rational denominator

Answers

Answer:

x = 4

Step-by-step explanation:

since the triangle is equilateral then the vertex angles are congruent, each 60°

using the sine ratio in the right triangle with x as its hypotenuse and the exact value

sin60° = [tex]\frac{\sqrt{3} }{2}[/tex] , then

sin60° = [tex]\frac{opposite}{hypotenuse}[/tex] = [tex]\frac{\sqrt{12} }{x}[/tex] = [tex]\frac{\sqrt{3} }{2}[/tex] ( cross- multiply )

x × [tex]\sqrt{3}[/tex] = 2[tex]\sqrt{12}[/tex] ( divide both sides by [tex]\sqrt{3}[/tex] )

x = [tex]\frac{2\sqrt{12} }{\sqrt{3} }[/tex] = 2 × [tex]\sqrt{\frac{12}{3} }[/tex] = 2 × [tex]\sqrt{4}[/tex] = 2 × 2 = 4

If f(x)=x squared-2x and g(x) = 6x+4 for which is a value of x does (f+g)(x) =0

Answers

Answer:

For [tex]x = -2[/tex]

Step-by-step explanation:

Solving a quadratic equation:

Given a second order polynomial expressed by the following equation:

[tex]ax^{2} + bx + c, a\neq0[/tex].

This polynomial has roots [tex]x_{1}, x_{2}[/tex] such that [tex]ax^{2} + bx + c = a(x - x_{1})*(x - x_{2})[/tex], given by the following formulas:

[tex]x_{1} = \frac{-b + \sqrt{\Delta}}{2*a}[/tex]

[tex]x_{2} = \frac{-b - \sqrt{\Delta}}{2*a}[/tex]

[tex]\Delta = b^{2} - 4ac[/tex]

In this question:

[tex]f(x) = x^2 - 2x[/tex]

[tex]g(x) = 6x + 4[/tex]

[tex]f(x) + g(x) = (f+g)(x)  = x^2 - 2x + 6x + 4 = x^2 + 4x + 4[/tex]

Which is a value of x does (f+g)(x) =0

[tex]x^2 + 4x + 4[/tex]

Quadratic equation with [tex]a = 1, b = 4, c = 4[/tex]

So

[tex]\Delta = 4^{2} - 4*1*4 = 0[/tex]

[tex]x_{1} = \frac{-4 + \sqrt{0}}{2} = -2[/tex]

[tex]x_{2} = \frac{-4 - \sqrt{0}}{2} = -2[/tex]

For [tex]x = -2[/tex]

An cylindrical oatmeal container has a diameter of 5 inches and a volume of 239.425
in. What measurement is closest to the lateral surface area of the oatmeal
container?
230.81 in 2
o
191.54 in.2
15.24 in.2
478.85 in.2

Answers

Answer:478.85 in2

Step-by-step explanation:

Just divide LOL

3. The third side of a triangle measures (3x-5) cm. If the length of the midline is 14 m,
what is x?
A 8
C. 10
B. 9
D. 11

Answers

Answer:

D. 11

Step-by-step explanation:

Midsegment theorem:

The length of the midsegment of a triangle is half the length of it's third side.

In this question:

Third side: 3x - 5

Midsegment: 14m

So

[tex]\frac{3x - 5}{2} = 14[/tex]

[tex]3x - 5 = 28[/tex]

[tex]3x = 33[/tex]

[tex]x = \frac{33}{3}[/tex]

[tex]x = 11[/tex]

The correct answer is given by option D.

here's this too!!!!!

Answers

Answer:

6. (a-4)(a+9)

7. (3p+4)(p-2)

8. Will explain below.

9. (5b+4)(5b-4)

Step-by-step explanation:

HELLOOO IM BACK

6. -4*9 = -36 (the variable), 9-4 = 5 (a) , so a^2 +5a - 36 is fulfilled.

7. 4*-2 = -8, 4-2 = 2, so 3p^2 - 2p - 8 is fulfilled.

9. 25b^2 = (5b)^2

16 = 4^2

Using the difference of squares formula, a^2-b^2= (a+b)(a-b)

What is the average rate of change of the function =2sin(1/2)on the interval [0, π]?

Answers

Answer:

4/x = [tex]\frac{\pi }{6}[/tex], 5 [tex]\frac{\pi }{6}[/tex]

Step-by-step explanation:

Sorry if I am wrong

The average rate of change of the function in the given interval [0, π] is [tex]\dfrac{2}{\pi }[/tex].

What is the average rate of change?

The average Rate of Change of the function f(x) can be calculated as;

[tex]f(x) = \dfrac{f(b) - f(a)}{b-a}[/tex]

The given function is f(x) = 2sin(1/2)x on the interval [0, π]

Here a = 0

b = π

f(a) = 2sin(1/2)a

f(0) = 0

f(b) = 2sin(1/2)π = 2

Step 2: Find Average

[tex]f(x) = \dfrac{f(b) - f(a)}{b-a}\\\\f(x) = \dfrac{2- 0}{\pi }\\\\f(x) = \dfrac{2}{\pi }\\[/tex]

Therefore, the average rate of change of the function in the given interval [0, π] is [tex]\dfrac{2}{\pi }[/tex].

Learn more about average rate;

https://brainly.com/question/20784578

#SPJ2

The mean grade in Mathematics of Grade 11 students from school A is 83 with standard deviation of 4, while the mean grade in Mathematics of Grade 11 students from school B is 87 with standard deviation of 5. Using 49 samples from school A and 64 from school B, what is the probability that the mean grade of students from school B exceeds the mean grade of students from school A by at least 3 but less than 5?

Answers

Using the context surrounding the word trough in line 9 of "Concrete Mixers," explain what a trough looks like and what it does on a concrete mixer. .

sorry I can't delete it this not answer your question

In the image below, line q is parallel to liner, and line s is a transversal.
D
9
B
What is the relationship between the measures of ZAand ZB?
The measures of Aand ZB are
becuase they are

Answers

Answer:

equal

alternate exterior angles

Step-by-step explanation:

The measure of given angles are equal to each other because they are alternate exterior angles,

Can someone please give me this answer

Answers

Answer:

42°

Step-by-step explanation:

According to Exterior Angle Theorem,

an exterior angle of a ∆ is equal to the sum of the opposite interior angles.

So,

h+96°=138°

h=138°-96°

h=42°

are these correct???

Answers

Answer:

They are all correct.

Step-by-step explanation:

1.

1/2(b)(h)

1/2(4)(6)

1/2(24)

12

2. l x w

7 x 5

35

3. (b)(h)

(8)(4)

32

Wendy bought a silver necklace online. It cost $23.15 plus 20% shipping and handling. What was the total cost?

Answers

The Wendy spent $27.78 on a silver necklace online.To calculate the total cost of the silver necklace, we need to add the cost of the necklace to the shipping and handling charges.

The cost of the necklace is given as $23.15.

Wendy bought a silver necklace online. It cost $23.15 plus 20% shipping and handling.

What was the total cost?When purchasing a silver necklace online, Wendy spent $23.15, but she had to pay for shipping and handling as well, which cost 20% of the total price of the item.

To find the total cost of the necklace, follow these steps:

1. Determine the cost of shipping and handling: $23.15 × 0.20 = $4.632

Add the cost of shipping and handling to the cost of the necklace:$23.15 + $4.63 = $27.78

The total cost of the necklace is $27.78.

It's important to consider the additional charges such as shipping and handling when calculating the total cost of an online purchase to have an accurate understanding of the amount spent.

To learn more about : spent

https://brainly.com/question/28997306

#SPJ8

Michael is buying a pair of jeans that regularly cost $40. They are on sale for 15% off. If the tax rate is 8.5%, what is the finale price of the jeans? Write ONE equation and solve.

Answers

Answer:

139284 238

Step-by-step explanation:

HELP ME LOOK AT THE PHOTO

Answers

Answer:

The answer to the question provided is 7.

Step-by-step explanation:

[tex]7x + 9 = 8x + 2 \\ \frac{ - 8x \: \: \: \: = - 8x}{ - 1x + 9 = 2 } \\ \frac{ \: \: \: \: \: \: \: \: - 9 = - 9}{ \frac{ - 1x}{ - 1} = \frac{ - 7}{ - 1} } \\ x = 7[/tex]

[I apologize if this isn't the answer]

Please help, will give brainliest.

Answers

Answer:

There is nothing.

Step-by-step explanation:

Answer:

A line that starts at with a constant positive slope

Step-by-step explanation:

Hope it makes sense!!

Printer A prints 100 pages for $23.99. Printer B prints 275 sheets for $63.99. Which printer has the better rate of cost per page?

Printer A, because the approximate rate of Printer A, $0.24 per page, is greater than the approximate rate of Printer B, $0.23 per page
Printer A, because the approximate rate of Printer A, $4.16 per page, is less than the approximate rate of Printer B, $4.30 per page
Printer B, because the approximate rate of Printer A, $0.24 per page, is greater than the approximate rate of Printer B, $0.23 per page
Printer B, because the approximate rate of Printer A, $4.16 per page, is less than the approximate rate of Printer B, $4.30 per page
PLEASE HURRY I NEEED THIS RN :)

Answers

Printer A has the better rate of cost per page because the approximate rate of Printer A, $0.24 per page, is greater than the approximate rate of Printer B, $0.23 per page.

How to calculate the rate?

Rate demonstrates how many times one number can fit into another number. It contrast two numbers by ordinarily dividing them. A/B will be the formula if one is comparing one data point (A) to another data point (B).

In this case, Printer A prints 100 pages for $23.99. The rate is:

[tex]\sf = \dfrac{\$23.99}{100}[/tex]

[tex]\sf = 0.2399\thickapprox\$0.24 \ per \ page[/tex]

Printer B prints 275 sheets for $63.99. The rate is:

[tex]\sf = \dfrac{\$63.99}{275}[/tex]

[tex]\sf = 0.2327\thickapprox\$0.23 \ per \ page[/tex]

Therefore, based on the above calculations, we can see that Printer A has the better rate of cost per page because the approximate rate of Printer A, $0.24 per page, is greater than the approximate rate of Printer B, $0.23 per page.

So option (A) is correct.

Learn more about rate on:

brainly.com/question/25537936

In 2006, a sample of 200 in-store shoppers showed that 42 paid by debit card. In 2009, a sample of the same size showed that 80 paid by debit card. (a) Formulate appropriate hypotheses to test whether the percentage of debit card shoppers increased. (b) Carry out the test at alpha

Answers


Hope it help youuuuu

The percentage of debit shoppers has increased.

21% (2006) < 40% (2009)

In 2006, the percentage of debit shoppers is 21%.

In 2009, the percentage of debit shoppers is 40%.

What is a percentage?

The percentage is calculated by dividing the required value by the total value and multiplying by 100.

Example:

Required percentage value = a

total value = b

Percentage = a/b x 100

We have,

In 2006:

A sample of 200 in-store shoppers showed that 42 paid by debit card.

The percentage of debit shoppers in 2006.

= 42/200 x 100

= 42/2

= 21%

In 2009:

A sample of the same size showed that 80 were paid by debit card.

The percentage of debit shoppers in 2009.

= 80/200 x 100

= 40%

Thus,

The percentage of debit shoppers has increased.

21% (2006) < 40% (2009)

In 2006, the percentage of debit shoppers is 21%.

In 2009, the percentage of debit shoppers is 40%.

Learn more about percentages here:

https://brainly.com/question/11403063

#SPJ5

NO LINKS!! URGENT HELP PLEASE!!

Find the probability of each event.

28. One day, 9 babies are born at a hospital. Assuming each baby has an equal chance of being a boy or girl, what is the probability that exactly 4 of the 9 babies are girls?

29. A gambler places a bet on a horse race. To win, he must pick the top 3 finishers in order. 13 horses of equal ability are entered in the race. Assuming the horses finish in random order, what is the probability that the gambler will win his bet?

Answers

Answer:

28. 0.2461 or 24.61%.

29. 0.00058275 or 0.058275%.

Step-by-step explanation:

Question 28:

we can use the binomial probability formula to calculate the probability:

[tex]\boxed{\bold{P(X = k) = (nCk) * p^k * (1 - p)^(n - k)}}[/tex]

Where:

P(X = k) is the probability of getting exactly k successesnCk is the number of combinations of n items taken k at a timep is the probability of a single successn is the total number of trials

In this case, we have n = 9 babies, and each baby has a 50% chance of being a girl (p = 0.5). We want to find the probability that exactly 4 of them are girls (k = 4).

Using the formula, we can calculate the probability as follows:

[tex]\bold{P(X = 4) = (9C4) * (0.5)^4 * (1 - 0.5)^(9 - 4)}[/tex]

Calculating the values:

(9C4) = 126 (0.5)^4 = 0.0625(1 - 0.5)^(9 - 4) = 0.5^5 = 0.03125

Now, we can substitute these values into the formula:

P(X = 4) = 126 * 0.0625 * 0.03125 = 0.2461 or 24.61%

Therefore, the probability that exactly 4 out of 9 babies are girls is approximately 0.2461 or 24.61%.

Question 29:

We need to calculate the number of possible outcomes to calculate this probability, where the gambler correctly predicts the top 3 finishers in order and divides it by the total number of possible outcomes.

The total number of possible outcomes is the number of permutations of 13 horses taken 3 at a time.

This can be calculated as:

[tex]13P3 = \frac{13! }{(13 - 3)! }= \frac{13! }{ 10! }=\frac{13*12*11*10! }{ 10! }= 13 * 12 * 11 = 1,716[/tex]

Now,

To calculate the number of favorable outcomes where the gambler predicts the top 3 finishers correctly, we need to consider that there is only one correct order for the horses to finish.

Therefore, there is only one favorable outcome.

The probability of the gambler winning his bet is given by:

[tex]\boxed{\bold{P\:(winning) = \frac{Number\: of \:favorable\: outcomes }{ Total \:number \:of \:outcomes}}}[/tex]

[tex]P(winning) = \frac{1 }{1,716}=0,00058275 \: or\:0.058275%[/tex]

Therefore, the probability that the gambler will win his bet is approximately 0.00058275 or 0.058275%.

Answer:

28)  0.246 = 24.6%

29)  1/286 = 0.350%

Step-by-step explanation:

Question 28

We can model the given scenario as a binomial distribution.

Binomial distribution

[tex]X \sim \text{B}(n,p)[/tex]

where:

X is the random variable that represents the number of successes.n is the fixed number of independent trials.p is the probability of success in each trial.

Given the probability that a baby is born a girl is 0.5, and the number of babies is 9:

[tex]\boxed{X \sim \text{B}(9,0.5)}[/tex]

where the random variable X represents the number of babies who are girls.

To find the probability that at exactly 4 babies are girls, we need to find P(X = 4).

To do this, we can use the binomial distribution formula:

[tex]\boxed{\displaystyle \text{P}(X=x)=\binom{n}{x} \cdot p^x \cdot (1-p)^{n-x}}[/tex]

Substitute the values of n = 9, p = 0.5 and x = 4 into the formula:

[tex]\begin{aligned}\displaystyle \text{P}(X=4)&=\binom{9}{4} \cdot 0.5^4 \cdot (1-0.5)^{9-4}\\\\&=\dfrac{9!}{4!\:(9-4)!} \cdot 0.5^4 \cdot 0.5^{5}\\\\&=126 \cdot 0.0625 \cdot 0.03125\\\\& = 0.24609375\end{aligned}[/tex]

Therefore, the probability that 4 babies from a sample of 9 babies are girls is 0.246 (3 s.f.) or 24.6%.

We can also use the binomial probability density function of a calculator to calculate P(X = 4).

Inputting the values of n = 9, p = 0.5 and x = 4 into the binomial pdf:

[tex]\text{P}(X=4)=0.24609375[/tex]

Therefore, this confirms that the probability that 4 babies from a sample of 9 babies are girls is 0.246 (3 s.f.) or 24.6%.

[tex]\hrulefill[/tex]

Question 29

To calculate the probability that the gambler will win his bet, we need to determine the number of favorable outcomes (winning combinations) and the total number of possible outcomes.

The gambler wins if he picks the top three horses in any order. There are 6 ways for the three winners to be arranged in the top three.

There are a total of 13 horses in the race.

The number of ways to choose the first-place horse is 13. After the first-place horse is chosen, there are 12 remaining horses, so the number of ways to choose the second-place horse is 12. Finally, after the first two horses are chosen, there are 11 remaining horses, so the number of ways to choose the third-place horse is 11.

Therefore, the total number of possible outcomes is:

[tex]13 \times 12 \times 11 = 1716[/tex]

Therefore, the probability that the gambler will win his bet is:

[tex]\begin{aligned} \sf Probability &=\sf \dfrac{Favorable \;outcomes}{Total\;outcomes}\\\\&=\dfrac{6}{1716}\\\\&=\dfrac{1}{286}\\\\ & \approx0.350\%\; \sf (3\;d.p.)\end{aligned}[/tex]

Label the spinner below with the letters A though J. What is the probability of landing on a vowel on the spinner and rolling a number greater that 4 on the fair number cube?

Answers

Answer:

3 for vowles and two for number

Step-by-step explanation:

I also need help on this one just need points

A small publishing company is planning to publish a new book. The production costs will include one-time fixed costs (such as editing) and variable costs (such as printing). There are two production methods it could use. With one method, the one-time fixed costs will total 44,907, and the variable costs will be per book. With the other method, the one-time fixed costs will total 22,907, and the variable costs will be 23.25 per book. For how many books produced will the costs from the two methods be the same?

Answers

Substituting the given variable cost per book for Method 1 (which is not specified), we can calculate the value of 'x' that makes the costs equal for the two methods.

Let's assume the number of books produced is denoted by 'x'. We need to find the value of 'x' for which the costs from the two methods are the same.

For the first method, the total cost is the sum of the one-time fixed cost and the variable cost per book:

Total cost for Method 1 = 44,907 + (variable cost per book) * x

For the second method, the total cost is the sum of the one-time fixed cost and the variable cost per book:

Total cost for Method 2 = 22,907 + (23.25 * x)

To find the number of books produced when the costs from the two methods are equal, we set the total costs equal to each other and solve for 'x':

44,907 + (variable cost per book) * x = 22,907 + (23.25 * x)

Subtracting (23.25 * x) from both sides and rearranging the equation:

21,000 = 23.25 * x - (variable cost per book) * x

21,000 = x * (23.25 - (variable cost per book))

Dividing both sides by (23.25 - (variable cost per book)):

x = 21,000 / (23.25 - (variable cost per book))

Substituting the given variable cost per book for Method 1 (which is not specified), we can calculate the value of 'x' that makes the costs equal for the two methods.

For more such questions on variable

https://brainly.com/question/25223322

#SPJ8

Other Questions
7. Explain the rational decisions that the company heads took to make Skoda a reliable brand for the consumers. .Classify each of the following traits depending on the type of flu vaccine being described. Some traits may be used more than once.The trivalent vaccine ____.The quadrivalent vaccine _____.Nasal spray _____.contains 2 A viruses, contains one B virus, and virus particles are inactivated and not capable of reproducingcontains 2 A viruses, virus particles are inactivated and not capable of reproducing, and contains 2 types of influenza B viruscontains weakened versions of influenza and may produce flu like symptoms Suppose the marginal product of labor is MPN = 200 - 0.5N where N is aggregate employment. The aggregate quantity of labor supplied is 100 + 4w, where w is the real wage. The government imposes a minimum wage of 60. How much unemployment will this create among unskilled labor?a. 0 b. 60 c. 80 d. 100 Today is 1 July, 2022. Rajesh is planning to purchase a corporate bond with a coupon rate of j2 = 6.05% p.a. and face value of $1000. This corporate bond matures at par. The maturity date is 1 July, 2024. The yield rate is assumed to be j2 = 3.29% p.a. Assume that this corporate bond has a 3.83% chance of default in the first six-month period (i.e., from 1 July 2022 to 31 December 2022) and this corporate bond has a 3.2% chance of default in any six-month period during the term of the bond except the first six- month (i.e., 3.2% chance of default in any six-month from 1 January 2023 to 1 July 2024). Assume also that, if default occurs, Rajesh will receive no further payments at all. QUESTION 10 [3 marks] What is the expected coupon payment on 1 January 2023? a. $28.1605 b. $28.620 6 c. $29.2820 d. $29.091 4 Consider a regular surface S in R given by x2 + y2 = 2022. Is S orientable ? Justify your answer. the scrum framework encompasses rules or guidelines for architecture?True or False the heights of mature pecan trees are approximately normally distributes with a mean of 42 feet and a standard deviation of 7.5 feet. what proportion are between 43 and 46 feet tall. Westgate Inc. uses a lean manufacturing strategy to manufacture DVR (digital video recorder) players. The company manufactures DVR players through a single product cell. The budgeted conversion cost for the year is $741,600 for 2,060 production hours. Each unit requires 12 minutes of cell process time. During March, 840 DVR players were manufactured in the cell. The materials cost per unit is $66. The following summary transactions took place during March: 1. Materials were purchased for March production. 2. Conversion costs were applied to production. 3. 840 DVR players were assembled and placed in finished goods. 4. 800 DVR players were sold for $244 per unit. a. Determine the budgeted cell conversion cost per hour. If required, round to the nearest dollar. b. Determine the budgeted cell conversion cost per unit. If required, round to the nearest dollar. which of the following statements correctly describes the function of a signal peptide in the context of barriers to social perception, _____ is our tendency to prefer information that supports our viewpoints. how to trade the traditional momentum strategy in the most accurate way? suppose today is month t and you can only buy stocks like aqr but not short sell stocks. the choke price (price intercept of the demand function) is $10. the current price of the good is $4 and consumers demand 6 units at that price. calculate the consumer surplus. It has now been 3 years since Burnin' Rock was launched, and after a shaky start in the introduction stage, the product appears to be entering the maturity stage of the product life cycle. Product sales remain strong, but many competitors have entered the market. The Vice President of Marketing stops by your office and asks how you plan to sustain Burnin' Rock's market growth.a.) Continue to grow sales by finding new users and new market segments for Burnin' Rock.b.) Rebrand completely, changing the name so it seems like a brand new product.c.) Reduce advertising expenditures to a minimal level to shrink expenses. TRUE / FALSE. Question 2 [CLO-6] While Present Worth is a very popular metric in estimating a project's profitability, it can't be used alone in evaluation. The large parts of a playground A-frame (from which to hang a swing or glider) consist of a ridge pole, four legs, and two side braces. Each pair of legs fastens to the ridge with one fastener set. Each side brace requires two fastener sets for attachment to the legs. Each fastener set includes one zinc-plated bolt, one lock-washer, and one nut. [3+3=6] There is one order outstanding, to make 80 frame kits. There are 200 legs in inventory. There are no other large items in inventory, and no scheduled receipts. Fasteners are available from the small parts area. i. Draw the product structure tree ii. Calculate the net requirements to fulfill the outstanding order. By examining data from distant stars, astronomers can determineif a star is moving away from or toward Earth. Which of thefollowing pieces of data would be most helpful in determiningthe motion of a star?A The star gives off blue-white light.B The star gives off mainly radio waves and X-rays.CThe light spectrum given off by the star is shifted toward thered end..DThe surface temperature of the star is approximately 10,000Celsius. The incremental operating cash flows of an investment may include the following: O Change in depreciation expenses Change in operating expenses Change in tax Change in revenues Change in capital outlay if you put a drinking straw in water, place your finger over the opening, and lift the straw out of the water, some water stays in the straw. explain. Se lanza un objeto hacia arriba y en 3.2 segundos cae. Determinar la altura mxima a la que lleg y la velocidad con la que choca con el piso. C2H5OH(l)+3O2(g)2CO2(g)+3H2O(g)If 9.2g of C2H5OH(l) burns completely in the presence of excess O2(g) according to the equation, how many grams of CO2(g) are produced?A:0.40gB:8.8gC:9.2gD:18g